EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42N4O6 |
| Net Charge | 0 |
| Average Mass | 542.677 |
| Monoisotopic Mass | 542.31044 |
| SMILES | CC(C)[C@@H]1NC(=O)C[C@H](/C=C/c2ccccc2)OC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C29H42N4O6/c1-16(2)23-27(36)30-19(7)26(35)32-24(17(3)4)28(37)33-25(18(5)6)29(38)39-21(15-22(34)31-23)14-13-20-11-9-8-10-12-20/h8-14,16-19,21,23-25H,15H2,1-7H3,(H,30,36)(H,31,34)(H,32,35)(H,33,37)/b14-13+/t19-,21+,23+,24+,25+/m1/s1 |
| InChIKey | YCQYXHBWHHEYIM-DNSLKWDESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthrobacterspecies (ncbitaxon:1667) | - | PubMed (26575343) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arthroamide (CHEBI:216253) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6S,9R,12S,16R)-9-methyl-16-[(E)-2-phenylethenyl]-3,6,12-tri(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone |
| Manual Xrefs | Databases |
|---|---|
| 58919186 | ChemSpider |