EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O7 |
| Net Charge | 0 |
| Average Mass | 314.334 |
| Monoisotopic Mass | 314.13655 |
| SMILES | C=C(CO)C(=O)O[C@@H]1[C@@H](O)[C@@H](O)C(C=CC(C)(C)O)=C[C@H]1O |
| InChI | InChI=1S/C15H22O7/c1-8(7-16)14(20)22-13-10(17)6-9(11(18)12(13)19)4-5-15(2,3)21/h4-6,10-13,16-19,21H,1,7H2,2-3H3/t10-,11+,12+,13+/m1/s1 |
| InChIKey | NBZUDMBUVXXWMW-VOAKCMCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lentinus (ncbitaxon:5357) | - | PubMed (29597242) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lentinoid C (CHEBI:216250) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| [(1S,2R,5S,6S)-2,5,6-trihydroxy-4-(3-hydroxy-3-methylbut-1-enyl)cyclohex-3-en-1-yl] 2-(hydroxymethyl)prop-2-enoate |