EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H46O17 |
| Net Charge | 0 |
| Average Mass | 798.791 |
| Monoisotopic Mass | 798.27350 |
| SMILES | C[C@@H]1Cc2cc(O)cc(O)c2C(=O)O[C@H](C)CC(=O)O[C@H](C)Cc2cc(O)cc(O)c2C(=O)O[C@H](C)C[C@@H](O)Cc2cc(O)cc(O)c2C(=O)O[C@H](C)CC(=O)O1 |
| InChI | InChI=1S/C40H46O17/c1-18-6-23-11-27(42)15-30(45)35(23)38(50)55-20(3)8-26(41)13-25-14-29(44)17-32(47)37(25)40(52)57-22(5)10-34(49)54-19(2)7-24-12-28(43)16-31(46)36(24)39(51)56-21(4)9-33(48)53-18/h11-12,14-22,26,41-47H,6-10,13H2,1-5H3/t18-,19-,20-,21-,22-,26-/m1/s1 |
| InChIKey | MZOGTSLLZCHVTJ-ACLVMWMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Menisporopsis theobromae (ncbitaxon:752604) | - | PubMed (15104506) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Menisporopsin A (CHEBI:216247) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (4R,6S,16R,20R,30R,34R)-6,10,12,24,26,38,40-heptahydroxy-4,16,20,30,34-pentamethyl-3,15,19,29,33-pentaoxatetracyclo[34.4.0.08,13.022,27]tetraconta-1(36),8(13),9,11,22(27),23,25,37,39-nonaene-2,14,18,28,32-pentone |
| Manual Xrefs | Databases |
|---|---|
| 4440685 | ChemSpider |