EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO2 |
| Net Charge | 0 |
| Average Mass | 191.230 |
| Monoisotopic Mass | 191.09463 |
| SMILES | C=CCCc1ccc(C(=O)OC)nc1 |
| InChI | InChI=1S/C11H13NO2/c1-3-4-5-9-6-7-10(12-8-9)11(13)14-2/h3,6-8H,1,4-5H2,2H3 |
| InChIKey | LYCDOHVYYYUHNB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium nygamai (ncbitaxon:42673) | - | DOI (10.1016/0031-9422(95)00716-4) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10-dehydrofusaric acid methyl ester (CHEBI:216236) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| methyl 5-but-3-enylpyridine-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78435132 | ChemSpider |