EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H79N5O9 |
| Net Charge | 0 |
| Average Mass | 822.142 |
| Monoisotopic Mass | 821.58778 |
| SMILES | CCC[C@H]1NC(=O)[C@@H](CC(C)C)OC(=O)[C@H](C(C)C)OC(=O)[C@@H](C(C)C)NC(=O)[C@H](C)[C@@H](CCC)NC(=O)[C@H](C)[C@@H](CCC)NC(=O)[C@H](C)[C@@H](CCC)NC(=O)[C@@H]1C |
| InChI | InChI=1S/C44H79N5O9/c1-15-19-31-28(12)39(51)47-33(21-17-3)30(14)41(53)49-36(25(7)8)43(55)58-37(26(9)10)44(56)57-35(23-24(5)6)42(54)48-34(22-18-4)29(13)40(52)46-32(20-16-2)27(11)38(50)45-31/h24-37H,15-23H2,1-14H3,(H,45,50)(H,46,52)(H,47,51)(H,48,54)(H,49,53)/t27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37+/m1/s1 |
| InChIKey | ZGUPGLAEKHCUSL-WLHCDTGTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | PubMed (26784681) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Medusamide A (CHEBI:216195) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6R,9R,10R,13R,14R,17R,18R,21R,22R,25R)-9,13,17,21-tetramethyl-25-(2-methylpropyl)-3,6-di(propan-2-yl)-10,14,18,22-tetrapropyl-1,4-dioxa-7,11,15,19,23-pentazacyclopentacosane-2,5,8,12,16,20,24-heptone |
| Manual Xrefs | Databases |
|---|---|
| 58196519 | ChemSpider |