EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O6 |
| Net Charge | 0 |
| Average Mass | 254.238 |
| Monoisotopic Mass | 254.07904 |
| SMILES | COc1cc2c(c(OC)c1C(=O)O)O[C@H](C)[C@H]2O |
| InChI | InChI=1S/C12H14O6/c1-5-9(13)6-4-7(16-2)8(12(14)15)11(17-3)10(6)18-5/h4-5,9,13H,1-3H3,(H,14,15)/t5-,9-/m1/s1 |
| InChIKey | UIPFPFNDMUGZKY-MLUIRONXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (30308383) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asperterreusine B (CHEBI:216161) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| (2R,3S)-3-hydroxy-5,7-dimethoxy-2-methyl-2,3-dihydro-1-benzouran-6-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048541 | ChemSpider |