EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H50N6O8 |
| Net Charge | 0 |
| Average Mass | 706.841 |
| Monoisotopic Mass | 706.36901 |
| SMILES | C/C=C(/NC(=O)CCCCCCC)C(=O)N/C(=C/C)C(=O)N[C@@H](C(=O)N[C@H](C(=O)Nc1ccc(C(N)=O)cc1)c1ccc(O)cc1)[C@@H](O)C(C)C |
| InChI | InChI=1S/C37H50N6O8/c1-6-9-10-11-12-13-29(45)40-27(7-2)34(48)41-28(8-3)35(49)43-31(32(46)22(4)5)37(51)42-30(23-16-20-26(44)21-17-23)36(50)39-25-18-14-24(15-19-25)33(38)47/h7-8,14-22,30-32,44,46H,6,9-13H2,1-5H3,(H2,38,47)(H,39,50)(H,40,45)(H,41,48)(H,42,51)(H,43,49)/b27-7+,28-8+/t30-,31+,32-/m0/s1 |
| InChIKey | HRCZDTQVIWUXRB-ALFULQJTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia plantarii (ncbitaxon:41899) | - | PubMed (32808751) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Haereoplantin E (CHEBI:216156) is a polypeptide (CHEBI:15841) |
| IUPAC Name |
|---|
| 4-[[(2S)-2-[[(2R,3S)-3-hydroxy-4-methyl-2-[[(E)-2-[[(E)-2-(octanoylamino)but-2-enoyl]amino]but-2-enoyl]amino]pentanoyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]benzamide |