EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O6 |
| Net Charge | 0 |
| Average Mass | 240.211 |
| Monoisotopic Mass | 240.06339 |
| SMILES | COc1cc2c(c(OC)c1C(=O)O)OC[C@H]2O |
| InChI | InChI=1S/C11H12O6/c1-15-7-3-5-6(12)4-17-9(5)10(16-2)8(7)11(13)14/h3,6,12H,4H2,1-2H3,(H,13,14)/t6-/m1/s1 |
| InChIKey | OWIJLQLPOIFVQO-ZCFIWIBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (30308383) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asperterreusine A (CHEBI:216155) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| (3S)-3-hydroxy-5,7-dimethoxy-2,3-dihydro-1-benzouran-6-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442221 | ChemSpider |