EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O6 |
| Net Charge | 0 |
| Average Mass | 240.211 |
| Monoisotopic Mass | 240.06339 |
| SMILES | COC(=O)c1c(OC)cc(OC)cc1C(=O)O |
| InChI | InChI=1S/C11H12O6/c1-15-6-4-7(10(12)13)9(11(14)17-3)8(5-6)16-2/h4-5H,1-3H3,(H,12,13) |
| InChIKey | IVQQBKGPJZNVKB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria intracolorata (ncbitaxon:743261) | - | PubMed (16644525) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Coloratin B (CHEBI:216130) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 3,5-dimethoxy-2-methoxycarbonylbenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78434876 | ChemSpider |