EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38N4O8 |
| Net Charge | 0 |
| Average Mass | 630.698 |
| Monoisotopic Mass | 630.26896 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](N)Cc2ccc(OC)c(c2)-c2cc3cc(c2O)Oc2ccc(cc2)C[C@@H](C(=O)O)NC(=O)[C@H](C3)NC1=O |
| InChI | InChI=1S/C34H38N4O8/c1-4-17(2)29-33(42)36-25-15-20-12-23(22-11-19(7-10-27(22)45-3)13-24(35)31(40)38-29)30(39)28(16-20)46-21-8-5-18(6-9-21)14-26(34(43)44)37-32(25)41/h5-12,16-17,24-26,29,39H,4,13-15,35H2,1-3H3,(H,36,42)(H,37,41)(H,38,40)(H,43,44)/t17-,24-,25-,26-,29-/m0/s1 |
| InChIKey | WKYLONYSKYXJSJ-UJGPGMDKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myxococcus (ncbitaxon:32) | - | PubMed (32639716) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cittilin A (CHEBI:216125) is a polypeptide (CHEBI:15841) |
| IUPAC Name |
|---|
| (14S,17S,20S,23S)-14-amino-17-[(2S)-butan-2-yl]-32-hydroxy-9-methoxy-15,18,21-trioxo-2-oxa-16,19,22-triazapentacyclo[23.2.2.13,7.15,20.18,12]dotriaconta-1(27),3,5,7(32),8,10,12(31),25,28-nonaene-23-carboxylic acid |