EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38O11 |
| Net Charge | 0 |
| Average Mass | 562.612 |
| Monoisotopic Mass | 562.24141 |
| SMILES | CCCCCc1cc(O)cc(OC(=O)c2c(CCCCC)cc(O)cc2O[C@@H]2O[C@H](C(=O)O)[C@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C29H38O11/c1-3-5-7-9-16-11-18(30)14-20(12-16)38-28(37)22-17(10-8-6-4-2)13-19(31)15-21(22)39-29-25(34)23(32)24(33)26(40-29)27(35)36/h11-15,23-26,29-34H,3-10H2,1-2H3,(H,35,36)/t23-,24+,25+,26-,29+/m0/s1 |
| InChIKey | CDVSTZXXDMGJKX-MQYJMQNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascotricha (ncbitaxon:79810) | - | PubMed (19461671) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ascotricin B (CHEBI:216115) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| (2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(3-hydroxy-5-pentylphenoxy)carbonyl-3-pentylphenoxy]oxane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438108 | ChemSpider |