EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25N3O5 |
| Net Charge | 0 |
| Average Mass | 375.425 |
| Monoisotopic Mass | 375.17942 |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CCC(=O)O)NC1=O |
| InChI | InChI=1S/C19H25N3O5/c1-11(2)16-19(27)20-13(8-9-15(23)24)17(25)21-14(18(26)22-16)10-12-6-4-3-5-7-12/h3-7,11,13-14,16H,8-10H2,1-2H3,(H,20,27)(H,21,25)(H,22,26)(H,23,24)/t13-,14-,16-/m0/s1 |
| InChIKey | CTCHFPZQWNZVNJ-DZKIICNBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomaduraspecies RB99 (ncbitaxon:2691577) | - | PubMed (30453579) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Natalenamide A (CHEBI:216114) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| 3-[(2S,5S,8S)-5-benzyl-3,6,9-trioxo-8-propan-2-yl-1,4,7-triazonan-2-yl]propanoic acid |