EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13NO5S |
| Net Charge | 0 |
| Average Mass | 331.349 |
| Monoisotopic Mass | 331.05144 |
| SMILES | COc1cc(O)c(C(=O)O)c(-c2cc(O)c3ncsc3c2C)c1 |
| InChI | InChI=1S/C16H13NO5S/c1-7-9(5-12(19)14-15(7)23-6-17-14)10-3-8(22-2)4-11(18)13(10)16(20)21/h3-6,18-19H,1-2H3,(H,20,21) |
| InChIKey | DVFJBSZJKLTBAR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria (ncbitaxon:5598) | - | PubMed (30388842) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altenusinoide B (CHEBI:216093) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 2-hydroxy-6-(4-hydroxy-7-methyl-1,3-benzothiazol-6-yl)-4-methoxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048698 | ChemSpider |