EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O4 |
| Net Charge | 0 |
| Average Mass | 466.662 |
| Monoisotopic Mass | 466.30831 |
| SMILES | CC1=C[C@@H](C[C@@H](C)[C@H]2CC[C@@]3(C)C4=C(CC[C@]23C)[C@@]2(C)CCC(=O)C(C)(C)[C@@H]2CC4=O)OC1=O |
| InChI | InChI=1S/C30H42O4/c1-17(14-19-15-18(2)26(33)34-19)20-8-13-30(7)25-21(9-12-29(20,30)6)28(5)11-10-24(32)27(3,4)23(28)16-22(25)31/h15,17,19-20,23H,8-14,16H2,1-7H3/t17-,19-,20-,23+,28-,29-,30+/m1/s1 |
| InChIKey | PUNXNTSNSVCCKV-QTBNWNMBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma luteomarginatum (ncbitaxon:1579231) | - | PubMed (30240975) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(5alpha,23R,24Z)-lanosta-8,24-dien-3,7-dioxo-23,26-gamma-lactone (CHEBI:216068) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-1-[(2R)-4-methyl-5-oxo-2H-uran-2-yl]propan-2-yl]-2,5,6,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,7-dione |
| Manual Xrefs | Databases |
|---|---|
| 78442212 | ChemSpider |