EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H45N7O5 |
| Net Charge | 0 |
| Average Mass | 595.745 |
| Monoisotopic Mass | 595.34822 |
| SMILES | C/C=C1/CN(C(=O)[C@H](CCCCNC(=N)N)NC(=O)CC(C)C)C(C(=O)N[C@@H](Cc2cnc3ccccc23)C(=O)O)[C@@H]1C |
| InChI | InChI=1S/C31H45N7O5/c1-5-20-17-38(29(41)24(36-26(39)14-18(2)3)12-8-9-13-34-31(32)33)27(19(20)4)28(40)37-25(30(42)43)15-21-16-35-23-11-7-6-10-22(21)23/h5-7,10-11,16,18-19,24-25,27,35H,8-9,12-15,17H2,1-4H3,(H,36,39)(H,37,40)(H,42,43)(H4,32,33,34)/b20-5-/t19-,24+,25+,27?/m1/s1 |
| InChIKey | FVSHJVLTICYBGI-RGSNETFKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsis lucentensis (ncbitaxon:53441) | - | PubMed (17630797) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lucentamycin B (CHEBI:216055) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(3R,4E)-1-[(2S)-6-(diaminomethylideneamino)-2-(3-methylbutanoylamino)hexanoyl]-4-ethylidene-3-methylpyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoic acid |