EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23ClN2O8S |
| Net Charge | 0 |
| Average Mass | 522.963 |
| Monoisotopic Mass | 522.08636 |
| SMILES | C[C@@]12/C=C/C(=O)/C=C/C=C\c3coc(n3)/C([C@H](O)CCl)=N\OC(=O)C[C@@]([C@@]3(C(=O)O)CO3)(CC1)S2 |
| InChI | InChI=1S/C23H23ClN2O8S/c1-21-7-6-15(27)5-3-2-4-14-12-32-19(25-14)18(16(28)11-24)26-34-17(29)10-22(35-21,9-8-21)23(13-33-23)20(30)31/h2-7,12,16,28H,8-11,13H2,1H3,(H,30,31)/b4-2-,5-3+,7-6+,26-18-/t16-,21-,22-,23+/m1/s1 |
| InChIKey | SRTHRTWGDJJGDY-YWAQVVFGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (32310633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Largimycin A3 (CHEBI:216044) is a carboxylic acid (CHEBI:33575) |
| Largimycin A3 (CHEBI:216044) is a epoxide (CHEBI:32955) |