EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31N3O11S2 |
| Net Charge | 0 |
| Average Mass | 649.700 |
| Monoisotopic Mass | 649.14000 |
| SMILES | CC(=O)N[C@H](CS[C@H]1CC(=O)/C=C/C=C\c2coc(n2)/C([C@H]2CO2)=N\OC(=O)C[C@@]2([C@@]3(C(=O)O)CO3)CC[C@]1(C)S2)C(=O)O |
| InChI | InChI=1S/C28H31N3O11S2/c1-15(32)29-18(24(35)36)13-43-20-9-17(33)6-4-3-5-16-11-40-23(30-16)22(19-12-39-19)31-42-21(34)10-27(8-7-26(20,2)44-27)28(14-41-28)25(37)38/h3-6,11,18-20H,7-10,12-14H2,1-2H3,(H,29,32)(H,35,36)(H,37,38)/b5-3-,6-4+,31-22-/t18-,19-,20+,26+,27-,28+/m1/s1 |
| InChIKey | WETQRRWLMLVNIN-UUNPUGERSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (32310633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Largimycin A2 (CHEBI:216038) is a N-acyl-amino acid (CHEBI:51569) |