EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40N4O14S3 |
| Net Charge | 0 |
| Average Mass | 812.898 |
| Monoisotopic Mass | 812.17031 |
| SMILES | CC(=O)N[C@H](CSC[C@@H](O)/C1=N/OC(=O)C[C@@]2([C@@]3(C(=O)O)CO3)CC[C@@](C)(SC[C@@H](NC(C)=O)C(=O)O)[C@H](CC(=O)/C=C/C=C\c3coc1n3)S2)C(=O)O |
| InChI | InChI=1S/C33H40N4O14S3/c1-17(38)34-21(28(43)44)13-52-15-23(41)26-27-36-19(12-49-27)6-4-5-7-20(40)10-24-31(3,53-14-22(29(45)46)35-18(2)39)8-9-32(54-24,11-25(42)51-37-26)33(16-50-33)30(47)48/h4-7,12,21-24,41H,8-11,13-16H2,1-3H3,(H,34,38)(H,35,39)(H,43,44)(H,45,46)(H,47,48)/b6-4-,7-5+,37-26-/t21-,22-,23-,24+,31-,32-,33+/m1/s1 |
| InChIKey | MFQKLNRDQFKCIX-IFENHQAWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (32310633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Largimycin A1 (CHEBI:216032) is a N-acyl-amino acid (CHEBI:51569) |