EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29N3O4 |
| Net Charge | 0 |
| Average Mass | 351.447 |
| Monoisotopic Mass | 351.21581 |
| SMILES | CN[C@H](C(=O)N[C@@H](CCC1C=CC(NC(C)=O)C=C1)C(=O)O)C(C)C |
| InChI | InChI=1S/C18H29N3O4/c1-11(2)16(19-4)17(23)21-15(18(24)25)10-7-13-5-8-14(9-6-13)20-12(3)22/h5-6,8-9,11,13-16,19H,7,10H2,1-4H3,(H,20,22)(H,21,23)(H,24,25)/t13?,14?,15-,16-/m0/s1 |
| InChIKey | SOFSTVNBQFOELD-CKUJCDMFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies NRRL S-98 (ncbitaxon:1463922) | - | PubMed (31887014) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stravidin S4 (CHEBI:216030) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-4-(4-acetamidocyclohexa-2,5-dien-1-yl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]butanoic acid |