EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O2 |
| Net Charge | 0 |
| Average Mass | 244.334 |
| Monoisotopic Mass | 244.14633 |
| SMILES | C/C=C\C/C=C\C/C=C/C=C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C16H20O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-3,5-6,8-15H,4,7H2,1H3,(H,17,18)/b3-2-,6-5-,9-8+,11-10+,13-12+,15-14+ |
| InChIKey | PTCPAVLVTJCPSX-SKVITQCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia thailandensis (ncbitaxon:57975) | - | PubMed (31816232) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thailandene C (CHEBI:216018) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E,11Z,14Z)-hexadeca-2,4,6,8,11,14-hexaenoic acid |