EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29N3O4 |
| Net Charge | 0 |
| Average Mass | 411.502 |
| Monoisotopic Mass | 411.21581 |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C23H29N3O4/c1-15(2)13-20(22(28)25-18-12-8-7-11-17(18)23(29)30)26-21(27)19(24-3)14-16-9-5-4-6-10-16/h4-12,15,19-20,24H,13-14H2,1-3H3,(H,25,28)(H,26,27)(H,29,30)/t19-,20+/m1/s1 |
| InChIKey | UBDWLHPISVQREF-UXHICEINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Simplicillium (ncbitaxon:292631) | - | PubMed (30006088) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sinulariapeptide D (CHEBI:216007) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[(2S)-4-methyl-2-[[(2R)-2-(methylamino)-3-phenylpropanoyl]amino]pentanoyl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048862 | ChemSpider |