EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O6 |
| Net Charge | 0 |
| Average Mass | 516.719 |
| Monoisotopic Mass | 516.34509 |
| SMILES | C[C@@H]1C[C@@]2(OC(=O)[C@@H](C)[C@@H]2C)O[C@@H]2C[C@H]3[C@@H](CC[C@H]4C(C)(C)[C@H](O)C[C@@H](O)[C@]34C)[C@]3(C)C(=O)C[C@H]1[C@@]23C |
| InChI | InChI=1S/C31H48O6/c1-15-14-31(17(3)16(2)26(35)37-31)36-25-12-20-18(29(7)24(34)11-19(15)30(25,29)8)9-10-21-27(4,5)22(32)13-23(33)28(20,21)6/h15-23,25,32-33H,9-14H2,1-8H3/t15-,16+,17+,18-,19-,20+,21+,22-,23-,25-,28-,29-,30+,31+/m1/s1 |
| InChIKey | REYDUJKYCGUWEE-ARVUAJLDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fomes (ncbitaxon:40441) | - | PubMed (19182411) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fomefficinol B (CHEBI:216006) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (1S,2R,3'S,4'S,5S,7R,9R,10R,11S,13R,15S,17R,18R,21R)-7,9-dihydroxy-1,3',4',6,6,10,17,21-octamethylspiro[14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicosane-15,5'-oxolane]-2',20-dione |
| Manual Xrefs | Databases |
|---|---|
| 78438105 | ChemSpider |