EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40N4O5 |
| Net Charge | 0 |
| Average Mass | 524.662 |
| Monoisotopic Mass | 524.29987 |
| SMILES | CC[C@@H](C)[C@H](N)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](C(=O)Nc1ccccc1C(=O)O)[C@H](C)CC |
| InChI | InChI=1S/C29H40N4O5/c1-6-18(3)24(30)28(36)33(5)23(17-20-13-9-8-10-14-20)26(34)32-25(19(4)7-2)27(35)31-22-16-12-11-15-21(22)29(37)38/h8-16,18-19,23-25H,6-7,17,30H2,1-5H3,(H,31,35)(H,32,34)(H,37,38)/t18-,19-,23-,24+,25+/m1/s1 |
| InChIKey | ZFPYFFGAVOIWOP-KHBKAIFKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Simplicillium (ncbitaxon:292631) | - | PubMed (30006088) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sinulariapeptide B (CHEBI:215995) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[(2S,3R)-2-[[(2R)-2-[[(2S,3R)-2-amino-3-methylpentanoyl]-methylamino]-3-phenylpropanoyl]amino]-3-methylpentanoyl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048860 | ChemSpider |