EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O6 |
| Net Charge | 0 |
| Average Mass | 272.297 |
| Monoisotopic Mass | 272.12599 |
| SMILES | C[C@H]1CCC(=O)C[C@H](CC(O)C(=O)O)CCC(=O)O1 |
| InChI | InChI=1S/C13H20O6/c1-8-2-4-10(14)6-9(3-5-12(16)19-8)7-11(15)13(17)18/h8-9,11,15H,2-7H2,1H3,(H,17,18)/t8-,9+,11?/m0/s1 |
| InChIKey | KNSWCEPBKIEVGH-VUHGHZMFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cylindrocarpon (ncbitaxon:13474) | - | PubMed (29236361) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cylindrolactone A (CHEBI:215944) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 2-hydroxy-3-[(5S,10S)-10-methyl-2,7-dioxooxecan-5-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 64853572 | ChemSpider |