EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O5 |
| Net Charge | 0 |
| Average Mass | 344.407 |
| Monoisotopic Mass | 344.16237 |
| SMILES | COc1cc(/C(C)=C/[C@@H](C)C/C=C/C=C/C=C/C(=O)O)oc(=O)c1C |
| InChI | InChI=1S/C20H24O5/c1-14(10-8-6-5-7-9-11-19(21)22)12-15(2)17-13-18(24-4)16(3)20(23)25-17/h5-9,11-14H,10H2,1-4H3,(H,21,22)/b7-5+,8-6+,11-9+,15-12+/t14-/m0/s1 |
| InChIKey | KVKQQUOEVVLXNW-VIUKQFHRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cylindrocarpon (ncbitaxon:13474) | - | PubMed (29236361) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cylindropyrone A (CHEBI:215931) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2E,4E,6E,10E)-11-(4-methoxy-5-methyl-6-oxopyran-2-yl)-9-methyldodeca-2,4,6,10-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 64853570 | ChemSpider |