EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H52N2O7 |
| Net Charge | 0 |
| Average Mass | 600.797 |
| Monoisotopic Mass | 600.37745 |
| SMILES | CC(C)=CCOc1ccc(C[C@@H]2NC(=O)C(C)C(O)CC(C(C)CCCCC(C)O)OC(=O)[C@@H]3CCCCN3C2=O)cc1 |
| InChI | InChI=1S/C34H52N2O7/c1-22(2)17-19-42-27-15-13-26(14-16-27)20-28-33(40)36-18-9-8-12-29(36)34(41)43-31(21-30(38)25(5)32(39)35-28)23(3)10-6-7-11-24(4)37/h13-17,23-25,28-31,37-38H,6-12,18-21H2,1-5H3,(H,35,39)/t23?,24?,25?,28-,29-,30?,31?/m0/s1 |
| InChIKey | ZEPBFVDNQHEQEH-YVSZJDEZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusariumspecies (ncbitaxon:29916) | - | PubMed (12049526) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,12S)-7-hydroxy-9-(7-hydroxyoctan-2-yl)-6-methyl-3-[[4-(3-methylbut-2-enoxy)phenyl]methyl]-10-oxa-1,4-diazabicyclo[10.4.0]hexadecane-2,5,11-trione (CHEBI:215906) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,12S)-7-hydroxy-9-(7-hydroxyoctan-2-yl)-6-methyl-3-[[4-(3-methylbut-2-enoxy)phenyl]methyl]-10-oxa-1,4-diazabicyclo[10.4.0]hexadecane-2,5,11-trione |
| Manual Xrefs | Databases |
|---|---|
| 9236204 | ChemSpider |