EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O8 |
| Net Charge | 0 |
| Average Mass | 402.399 |
| Monoisotopic Mass | 402.13147 |
| SMILES | Cc1cc(O)cc(O)c1C(=O)Oc1cc(C)c(C(=O)O)c2c1C[C@@H](C(C)(C)O)O2 |
| InChI | InChI=1S/C21H22O8/c1-9-5-11(22)7-13(23)16(9)20(26)28-14-6-10(2)17(19(24)25)18-12(14)8-15(29-18)21(3,4)27/h5-7,15,22-23,27H,8H2,1-4H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | VOISZAZWZMMJKL-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stereum hirsutum (ncbitaxon:40492) | - | PubMed (25029175) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sterenin J (CHEBI:215897) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 4-(2,4-dihydroxy-6-methylbenzoyl)oxy-2-(2-hydroxypropan-2-yl)-6-methyl-2,3-dihydro-1-benzouran-7-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435358 | ChemSpider |