EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O3 |
| Net Charge | 0 |
| Average Mass | 312.409 |
| Monoisotopic Mass | 312.17254 |
| SMILES | CO[C@H]1COc2c(O)c3c(c4ccc(C)c1c24)CCCC3(C)C |
| InChI | InChI=1S/C20H24O3/c1-11-7-8-12-13-6-5-9-20(2,3)17(13)18(21)19-16(12)15(11)14(22-4)10-23-19/h7-8,14,21H,5-6,9-10H2,1-4H3/t14-/m0/s1 |
| InChIKey | PQOYLMLWOHGIOA-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies (ncbitaxon:5065) | - | PubMed (23457022) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspergiloid G (CHEBI:215826) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| 12-methoxy-6,6,14-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaen-8-ol |
| Manual Xrefs | Databases |
|---|---|
| 78435129 | ChemSpider |