EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O4 |
| Net Charge | 0 |
| Average Mass | 228.288 |
| Monoisotopic Mass | 228.13616 |
| SMILES | CCCCC(O)c1ccc(C(O)C(C)O)o1 |
| InChI | InChI=1S/C12H20O4/c1-3-4-5-9(14)10-6-7-11(16-10)12(15)8(2)13/h6-9,12-15H,3-5H2,1-2H3 |
| InChIKey | CNIZBYKGFNRHNT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ceriporia (ncbitaxon:40427) | - | DOI (10.1007/s10600-018-2377-0) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(5-(1-hydroxypentyl)furan-2-yl)propane-1,2-diol (CHEBI:215818) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 1-[5-(1-hydroxypentyl)uran-2-yl]propane-1,2-diol |