EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H50N8O8 |
| Net Charge | 0 |
| Average Mass | 770.888 |
| Monoisotopic Mass | 770.37516 |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)C[C@@H](O)[C@@H](Cc1cnc2ccccc12)NC(=O)CCNC(=O)[C@H](O)Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C40H50N8O8/c41-40(42)44-18-9-16-30(37(53)48-32(39(55)56)20-25-10-3-1-4-11-25)46-36(52)23-33(49)31(22-27-24-45-29-15-8-7-14-28(27)29)47-35(51)17-19-43-38(54)34(50)21-26-12-5-2-6-13-26/h1-8,10-15,24,30-34,45,49-50H,9,16-23H2,(H,43,54)(H,46,52)(H,47,51)(H,48,53)(H,55,56)(H4,41,42,44)/t30-,31-,32-,33-,34-/m1/s1 |
| InChIKey | COOJUUSFULEOTE-SLXQPGMDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis aeruginosa NIES-87 (ncbitaxon:449440) | - | PubMed (32696567) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Deoxykasumigamide (CHEBI:215815) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2R)-2-[[(2R)-5-(diaminomethylideneamino)-2-[[(3R,4R)-3-hydroxy-4-[3-[[(2R)-2-hydroxy-3-phenylpropanoyl]amino]propanoylamino]-5-(1H-indol-3-yl)pentanoyl]amino]pentanoyl]amino]-3-phenylpropanoic acid |