EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO5 |
| Net Charge | 0 |
| Average Mass | 215.205 |
| Monoisotopic Mass | 215.07937 |
| SMILES | COC(=O)/C=C/C(=O)N[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C9H13NO5/c1-6(9(13)15-3)10-7(11)4-5-8(12)14-2/h4-6H,1-3H3,(H,10,11)/b5-4+/t6-/m0/s1 |
| InChIKey | AXLMQGRRCSKYDG-OVCGOVNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | DOI (10.1007/s10600-018-2394-z) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-fumaryl-L-alanine dimethyl ester (CHEBI:215812) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| methyl (E)-4-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobut-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 71048829 | ChemSpider |