EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O6 |
| Net Charge | 0 |
| Average Mass | 286.284 |
| Monoisotopic Mass | 286.11649 |
| SMILES | COC(=O)[C@H](C)NC(=O)/C=C/C(=O)N[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C12H18N2O6/c1-7(11(17)19-3)13-9(15)5-6-10(16)14-8(2)12(18)20-4/h5-8H,1-4H3,(H,13,15)(H,14,16)/b6-5+/t7-,8-/m0/s1 |
| InChIKey | NZYZLYFPFACZFH-JBGJSGBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | DOI (10.1007/s10600-018-2394-z) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N'-bis[(S)-1-methoxycarbonylethyl]fumaric diamide (CHEBI:215808) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| methyl (2S)-2-[[(E)-4-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobut-2-enoyl]amino]propanoate |
| Manual Xrefs | Databases |
|---|---|
| 71048830 | ChemSpider |