EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10ClNO2 |
| Net Charge | 0 |
| Average Mass | 163.604 |
| Monoisotopic Mass | 163.04001 |
| SMILES | C=C(Cl)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H10ClNO2/c1-4(7)2-3-5(8)6(9)10/h5H,1-3,8H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | IFFHOISHOWGDDA-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycobacterium tuberculosis (ncbitaxon:1773) | - | DOI (10.1016/s0031-9422(98)00177-0) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-5-chloro-5-hexenoic acid (CHEBI:215801) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-5-chlorohex-5-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 57475124 | ChemSpider |