EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:215797 - Palustrisolide G
| Formula | C38H54O8 |
| Net Charge | 0 |
| Average Mass | 638.842 |
| Monoisotopic Mass | 638.38187 |
| SMILES | COC(=O)C[C@](C)(O)CC(=O)O[C@@H]1CC[C@]2(C)C3=C(C(=O)C[C@H]2C1(C)C)[C@]1(C)CC[C@H]([C@H](C)C[C@H]2OC(=O)C(C)=C2C)[C@@]1(C)C=C3 |
| InChI | InChI=1S/C38H54O8/c1-21(17-27-22(2)23(3)33(42)45-27)24-11-16-38(9)32-25(12-15-37(24,38)8)36(7)14-13-29(34(4,5)28(36)18-26(32)39)46-31(41)20-35(6,43)19-30(40)44-10/h12,15,21,24,27-29,43H,11,13-14,16-20H2,1-10H3/t21-,24-,27-,28+,29-,35+,36-,37-,38+/m1/s1 |
| InChIKey | PSXJMKVNDMXDEM-NNNSZHMUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fomitopsis palustris (ncbitaxon:2870670) | - | PubMed (29715599) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Palustrisolide G (CHEBI:215797) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| 1-O-[(3R,5R,10S,13R,14R,17R)-17-[(2R)-1-[(2R)-3,4-dimethyl-5-oxo-2H-uran-2-yl]propan-2-yl]-4,4,10,13,14-pentamethyl-7-oxo-1,2,3,5,6,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] 5-O-methyl (3S)-3-hydroxy-3-methylpentanedioate |
| Manual Xrefs | Databases |
|---|---|
| 78442195 | ChemSpider |