EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H56O9 |
| Net Charge | 0 |
| Average Mass | 644.846 |
| Monoisotopic Mass | 644.39243 |
| SMILES | CC1=C(C)[C@H](C[C@@H](C)[C@H]2CC[C@@]3(C)C4=C(C[C@H](O)[C@]23C)[C@@]2(C)CC[C@H](OC(=O)C[C@@](C)(O)CC(=O)O)C(C)(C)[C@@H]2[C@H](O)C4)OC1=O |
| InChI | InChI=1S/C37H56O9/c1-19(14-26-20(2)21(3)32(43)45-26)22-10-13-36(8)24-15-25(38)31-33(4,5)28(46-30(42)18-34(6,44)17-29(40)41)11-12-35(31,7)23(24)16-27(39)37(22,36)9/h19,22,25-28,31,38-39,44H,10-18H2,1-9H3,(H,40,41)/t19-,22-,25-,26+,27+,28+,31+,34+,35-,36+,37+/m1/s1 |
| InChIKey | NBCPQLQTQKPUNE-OVLAPWHISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fomitopsis palustris (ncbitaxon:2870670) | - | PubMed (29715599) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Palustrisolide F (CHEBI:215790) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (3S)-5-[[(3S,5R,6R,10S,12S,13R,14S,17R)-17-[(2R)-1-[(2S)-3,4-dimethyl-5-oxo-2H-uran-2-yl]propan-2-yl]-6,12-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3-hydroxy-3-methyl-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442194 | ChemSpider |