EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:215773 - Palustrisolide D
| Formula | C34H50O7 |
| Net Charge | 0 |
| Average Mass | 570.767 |
| Monoisotopic Mass | 570.35565 |
| SMILES | CC1=C(C)[C@H](C[C@@H](C)[C@H]2CC[C@@]3(C)C4=C(C[C@H](O)[C@]23C)[C@@]2(C)CC[C@@H](OC(=O)CC(=O)O)C(C)(C)[C@@H]2CC4)OC1=O |
| InChI | InChI=1S/C34H50O7/c1-18(15-24-19(2)20(3)30(39)40-24)21-11-14-33(7)22-9-10-25-31(4,5)27(41-29(38)17-28(36)37)12-13-32(25,6)23(22)16-26(35)34(21,33)8/h18,21,24-27,35H,9-17H2,1-8H3,(H,36,37)/t18-,21-,24+,25+,26+,27-,32-,33+,34+/m1/s1 |
| InChIKey | FKAIFDOROOLHBN-MSPYFRFISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fomitopsis palustris (ncbitaxon:2870670) | - | PubMed (29715599) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Palustrisolide D (CHEBI:215773) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| 3-[[(3R,5R,10S,12S,13R,14S,17R)-17-[(2R)-1-[(2S)-3,4-dimethyl-5-oxo-2H-uran-2-yl]propan-2-yl]-12-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3-oxopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442191 | ChemSpider |