EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17NO3 |
| Net Charge | 0 |
| Average Mass | 235.283 |
| Monoisotopic Mass | 235.12084 |
| SMILES | CC(=O)N[C@H](COC(C)=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c1-10(15)14-13(9-17-11(2)16)8-12-6-4-3-5-7-12/h3-7,13H,8-9H2,1-2H3,(H,14,15)/t13-/m0/s1 |
| InChIKey | WUFZMBIFIXQZRG-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | DOI (10.1007/s10600-018-2286-2) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2(S)-2-acetamido-3-phenylpropylacetate (CHEBI:215754) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| [(2S)-2-acetamido-3-phenylpropyl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 62988277 | ChemSpider |