EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O2 |
| Net Charge | 0 |
| Average Mass | 254.329 |
| Monoisotopic Mass | 254.13068 |
| SMILES | CC(C)c1c(O)cc(/C=C/c2ccccc2)cc1O |
| InChI | InChI=1S/C17H18O2/c1-12(2)17-15(18)10-14(11-16(17)19)9-8-13-6-4-3-5-7-13/h3-12,18-19H,1-2H3/b9-8+ |
| InChIKey | ZISJNXNHJRQYJO-CMDGGOBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus (ncbitaxon:626) | - | PubMed (3415225) |
| Roles Classification |
|---|
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benvitimod (CHEBI:215747) has role antipsoriatic (CHEBI:50748) |
| Benvitimod (CHEBI:215747) has role dermatologic drug (CHEBI:50177) |
| Benvitimod (CHEBI:215747) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| 5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol |
| Synonyms | Source |
|---|---|
| Benvitimod | ChEMBL |
| GSK-2894512 | ChEMBL |
| GSK2894512 | ChEMBL |
| tapinarof | ChEMBL |
| Tapinarof | ChEMBL |
| Vtama | ChEMBL |
| Citations |
|---|