EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O6 |
| Net Charge | 0 |
| Average Mass | 280.276 |
| Monoisotopic Mass | 280.09469 |
| SMILES | COc1cc(C(C)=CC(C)=CC(=O)O)oc(=O)c1CO |
| InChI | InChI=1S/C14H16O6/c1-8(5-13(16)17)4-9(2)11-6-12(19-3)10(7-15)14(18)20-11/h4-6,15H,7H2,1-3H3,(H,16,17) |
| InChIKey | MEDQAXZQSRVBQZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemphyliumspecies 33231 (ncbitaxon:1418481) | - | PubMed (24549154) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Infectopyrone A (CHEBI:215738) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 5-[5-(hydroxymethyl)-4-methoxy-6-oxopyran-2-yl]-3-methylhexa-2,4-dienoic acid |