EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40Cl2N4O6S2 |
| Net Charge | 0 |
| Average Mass | 675.701 |
| Monoisotopic Mass | 674.17663 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CNC(=O)c2csc(n2)[C@H](C(C)C)OC(=O)C(C)(C)[C@H](CCCC(C)(Cl)Cl)OC(=O)c2csc1n2 |
| InChI | InChI=1S/C29H40Cl2N4O6S2/c1-8-16(4)21-24-34-18(14-42-24)26(38)40-19(10-9-11-29(7,30)31)28(5,6)27(39)41-22(15(2)3)25-33-17(13-43-25)23(37)32-12-20(36)35-21/h13-16,19,21-22H,8-12H2,1-7H3,(H,32,37)(H,35,36)/t16-,19-,21-,22-/m0/s1 |
| InChIKey | MXKVWNSSDRMDBC-PWZKMPOXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Moorena bouillonii (ncbitaxon:207920) | - | PubMed (20704304) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 27-deoxylyngbyabellin A (CHEBI:215699) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (7S,14S,18S)-7-[(2S)-butan-2-yl]-14-(4,4-dichloropentyl)-15,15-dimethyl-18-propan-2-yl-13,17-dioxa-9,20-dithia-3,6,22,23-tetrazatricyclo[17.2.1.18,11]tricosa-1(21),8(23),10,19(22)-tetraene-2,5,12,16-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 25050782 | ChemSpider |