EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O5 |
| Net Charge | 0 |
| Average Mass | 274.272 |
| Monoisotopic Mass | 274.08412 |
| SMILES | COc1cc(C)c2c(c1O)Oc1cc(C)cc(O)c1O2 |
| InChI | InChI=1S/C15H14O5/c1-7-4-9(16)14-11(5-7)19-15-12(17)10(18-3)6-8(2)13(15)20-14/h4-6,16-17H,1-3H3 |
| InChIKey | ZBCUDMHDXSANIY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus nidulans (ncbitaxon:162425) | - | PubMed (29947411) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gibellulin D (CHEBI:215639) is a dibenzodioxine (CHEBI:23825) |
| IUPAC Name |
|---|
| 2-methoxy-4,8-dimethyldibenzo-p-dioxin-1,6-diol |