EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H30O5 |
| Net Charge | 0 |
| Average Mass | 518.609 |
| Monoisotopic Mass | 518.20932 |
| SMILES | O=C1O[C@]2(Cc3ccccc3)[C@@H](c3ccccc3)C[C@H](O)[C@](O)(c3ccccc3)[C@]23O[C@]13Cc1ccccc1 |
| InChI | InChI=1S/C34H30O5/c35-29-21-28(26-17-9-3-10-18-26)31(22-24-13-5-1-6-14-24)34(33(29,37)27-19-11-4-12-20-27)32(39-34,30(36)38-31)23-25-15-7-2-8-16-25/h1-20,28-29,35,37H,21-23H2/t28-,29+,31-,32-,33-,34+/m1/s1 |
| InChIKey | MDTCKIOSBREYAT-YNFXEPLVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kyrtuthrix (ncbitaxon:1906669) | - | PubMed (9548830) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maculalactone G (CHEBI:215638) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1aS,3aR,4R,6S,7R,7aS)-1a,3a-dibenzyl-6,7-dihydroxy-4,7-diphenyl-5,6-dihydro-4H-oxireno[2,3-c][1]benzouran-2-one |
| Manual Xrefs | Databases |
|---|---|
| 8729332 | ChemSpider |