EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO3 |
| Net Charge | 0 |
| Average Mass | 157.169 |
| Monoisotopic Mass | 157.07389 |
| SMILES | [H][C@@]1(C(=O)O)CCCN1C(C)=O |
| InChI | InChI=1S/C7H11NO3/c1-5(9)8-4-2-3-6(8)7(10)11/h6H,2-4H2,1H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | GNMSLDIYJOSUSW-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-proline (CHEBI:21560) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-L-proline (CHEBI:21560) is a N-acylpyrrolidine (CHEBI:46766) |
| N-acetyl-L-proline (CHEBI:21560) is a L-proline derivative (CHEBI:84186) |
| N-acetyl-L-proline (CHEBI:21560) is a pyrrolidinemonocarboxylic acid (CHEBI:46701) |
| Incoming Relation(s) |
| N-terminal N-acetyl-L-proline residue (CHEBI:140859) is substituent group from N-acetyl-L-proline (CHEBI:21560) |
| IUPAC Name |
|---|
| 1-acetyl-L-proline |
| Synonyms | Source |
|---|---|
| (2S)-1-acetylpyrrolidine-2-carboxylic acid | IUPAC |
| Acetylproline | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:68-95-1 | ChemIDplus |