EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O5 |
| Net Charge | 0 |
| Average Mass | 408.494 |
| Monoisotopic Mass | 408.19367 |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)C(=O)C[C@@H](c1ccc(O)cc1)O2 |
| InChI | InChI=1S/C25H28O5/c1-14(2)5-11-18-23(28)19(12-6-15(3)4)25-22(24(18)29)20(27)13-21(30-25)16-7-9-17(26)10-8-16/h5-10,21,26,28-29H,11-13H2,1-4H3/t21-/m0/s1 |
| InChIKey | HCNLDGTUMBOHKT-NRFANRHFSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,8-diprenylnaringenin (CHEBI:2156) has functional parent (S)-naringenin (CHEBI:17846) |
| 6,8-diprenylnaringenin (CHEBI:2156) has role antibacterial agent (CHEBI:33282) |
| 6,8-diprenylnaringenin (CHEBI:2156) has role plant metabolite (CHEBI:76924) |
| 6,8-diprenylnaringenin (CHEBI:2156) is a (2S)-flavan-4-one (CHEBI:140377) |
| 6,8-diprenylnaringenin (CHEBI:2156) is a 4'-hydroxyflavanones (CHEBI:140331) |
| 6,8-diprenylnaringenin (CHEBI:2156) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-bis(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| Senegalensin | KEGG COMPOUND |
| Lonchocarpol A | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6940246 | Reaxys |
| CAS:68236-11-3 | KEGG COMPOUND |
| CAS:68236-11-3 | ChemIDplus |
| Citations |
|---|