EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27N3O6 |
| Net Charge | 0 |
| Average Mass | 357.407 |
| Monoisotopic Mass | 357.18999 |
| SMILES | CC[C@H](C)[C@@H]1C(=O)O[C@H]1C(=O)NCCC[C@H](NC(=O)[C@H](C)N)C(=O)O |
| InChI | InChI=1S/C16H27N3O6/c1-4-8(2)11-12(25-16(11)24)14(21)18-7-5-6-10(15(22)23)19-13(20)9(3)17/h8-12H,4-7,17H2,1-3H3,(H,18,21)(H,19,20)(H,22,23)/t8-,9-,10-,11-,12+/m0/s1 |
| InChIKey | ZFCGPWGFGUDLHO-UHFZAUJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (10724015) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Belactosin C (CHEBI:215573) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-[[(2R,3S)-3-[(2S)-butan-2-yl]-4-oxooxetane-2-carbonyl]amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8841384 | ChemSpider |