EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO3 |
| Net Charge | 0 |
| Average Mass | 173.212 |
| Monoisotopic Mass | 173.10519 |
| SMILES | CC[C@H](C)[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-4-5(2)7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t5-,7-/m0/s1 |
| InChIKey | JDTWZSUNGHMMJM-FSPLSTOPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-isoleucine (CHEBI:21555) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-L-isoleucine (CHEBI:21555) is a N-acetylisoleucine (CHEBI:84056) |
| N-acetyl-L-isoleucine (CHEBI:21555) is a L-isoleucine derivative (CHEBI:84111) |
| N-acetyl-L-isoleucine (CHEBI:21555) is conjugate acid of N-acetyl-L-isoleucinate (CHEBI:133735) |
| Incoming Relation(s) |
| N-acetyl-L-isoleucinate (CHEBI:133735) is conjugate base of N-acetyl-L-isoleucine (CHEBI:21555) |
| N-terminal N-acetyl-L-isoleucine residue (CHEBI:140858) is substituent group from N-acetyl-L-isoleucine (CHEBI:21555) |
| IUPAC Name |
|---|
| N-acetyl-L-isoleucine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724890 | Reaxys |
| CAS:3077-46-1 | ChemIDplus |
| Citations |
|---|