EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H44O5 |
| Net Charge | 0 |
| Average Mass | 496.688 |
| Monoisotopic Mass | 496.31887 |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)[C@H]3CC[C@@]4(C)C(=C3CC[C@H]2C1(C)C)C[C@@H]1OC(=O)[C@H](CC(=O)C=C(C)C)[C@@H]14 |
| InChI | InChI=1S/C31H44O5/c1-17(2)14-19(33)15-21-27-24(36-28(21)34)16-23-20-8-9-25-29(4,5)26(35-18(3)32)11-13-30(25,6)22(20)10-12-31(23,27)7/h14,21-22,24-27H,8-13,15-16H2,1-7H3/t21-,22+,24+,25+,26-,27+,30-,31+/m1/s1 |
| InChIKey | OSKLJSAPBZXSEI-HEADDFQYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tricholoma imbricatum (ncbitaxon:54538) | - | PubMed (32534274) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tricholimbrin B (CHEBI:215540) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| [(4S,7R,8R,9R,12R,13R,16R,18R)-9,13,17,17-tetramethyl-7-(4-methyl-2-oxopent-3-enyl)-6-oxo-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1-en-16-yl] acetate |