EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H44O7 |
| Net Charge | 0 |
| Average Mass | 528.686 |
| Monoisotopic Mass | 528.30870 |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H]5[C@H](C[C@@]4(OO)C3=CC[C@H]2C1(C)C)OC(=O)[C@@H]5CC(=O)C=C(C)C |
| InChI | InChI=1S/C31H44O7/c1-17(2)14-19(33)15-20-26-23(37-27(20)34)16-31(38-35)22-8-9-24-28(4,5)25(36-18(3)32)11-12-29(24,6)21(22)10-13-30(26,31)7/h8,14,20-21,23-26,35H,9-13,15-16H2,1-7H3/t20-,21+,23+,24+,25-,26+,29-,30-,31-/m1/s1 |
| InChIKey | LDLFBUARGIGTDA-FIBOZCACSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tricholoma imbricatum (ncbitaxon:54538) | - | PubMed (32534274) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tricholimbrin A (CHEBI:215535) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| [(2S,4S,7R,8R,9R,12R,13S,16R,18R)-2-hydroperoxy-9,13,17,17-tetramethyl-7-(4-methyl-2-oxopent-3-enyl)-6-oxo-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1(20)-en-16-yl] acetate |