EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O4 |
| Net Charge | 0 |
| Average Mass | 188.183 |
| Monoisotopic Mass | 188.07971 |
| SMILES | CC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C7H12N2O4/c1-4(10)9-5(7(12)13)2-3-6(8)11/h5H,2-3H2,1H3,(H2,8,11)(H,9,10)(H,12,13)/t5-/m0/s1 |
| InChIKey | KSMRODHGGIIXDV-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (15331932) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-glutamine (CHEBI:21553) has role human metabolite (CHEBI:77746) |
| N-acetyl-L-glutamine (CHEBI:21553) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-L-glutamine (CHEBI:21553) is a N2-acetylglutamine (CHEBI:73685) |
| N-acetyl-L-glutamine (CHEBI:21553) is a N2-acyl-L-glutamine (CHEBI:17008) |
| N-acetyl-L-glutamine (CHEBI:21553) is conjugate acid of N-acetyl-L-glutaminate (CHEBI:143879) |
| N-acetyl-L-glutamine (CHEBI:21553) is enantiomer of N2-acetyl-D-glutamine (CHEBI:144430) |
| Incoming Relation(s) |
| N-acetyl-L-glutaminate (CHEBI:143879) is conjugate base of N-acetyl-L-glutamine (CHEBI:21553) |
| N2-acetyl-D-glutamine (CHEBI:144430) is enantiomer of N-acetyl-L-glutamine (CHEBI:21553) |
| IUPAC Names |
|---|
| (2S)-2-(acetylamino)-5-amino-5-oxopentanoic acid |
| NN2-acetyl-L-glutamine |
| Synonym | Source |
|---|---|
| N~2~-acetyl-L-glutamine | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 46 | DrugCentral |
| CN101468955 | Patent |
| HMDB0006029 | HMDB |
| NLQ | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727471 | Reaxys |
| CAS:35305-74-9 | ChemIDplus |
| Citations |
|---|