EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29N5O5 |
| Net Charge | 0 |
| Average Mass | 479.537 |
| Monoisotopic Mass | 479.21687 |
| SMILES | C[C@@H]1NC(=O)c2ccccc2NC(=O)[C@H](C)N(C)C(=O)c2ccccc2NC(=O)[C@H](C)N(C)C1=O |
| InChI | InChI=1S/C25H29N5O5/c1-14-24(34)29(4)15(2)21(31)28-20-13-9-7-11-18(20)25(35)30(5)16(3)22(32)27-19-12-8-6-10-17(19)23(33)26-14/h6-16H,1-5H3,(H,26,33)(H,27,32)(H,28,31)/t14-,15-,16-/m0/s1 |
| InChIKey | SRHCZSHNDDEHKH-JYJNAYRXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus versicolor (ncbitaxon:46472) | - | DOI (10.1002/hlca.201000408) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Versicotide A (CHEBI:215523) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (4S,15S,18S)-4,5,15,16,18-pentamethyl-2,5,13,16,19-pentazatricyclo[19.4.0.07,12]pentacosa-1(25),7,9,11,21,23-hexaene-3,6,14,17,20-pentone |
| Manual Xrefs | Databases |
|---|---|
| 28185128 | ChemSpider |